C8H13F2NO2 — CID 121215401
2-[4-(difluoromethyl)piperidin-1-yl]acetic acid (PubChem CID 121215401) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-(difluoromethyl)piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 121215401 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-[4-(difluoromethyl)piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(C(F)F)CC1 |
| InChI | InChI=1S/C8H13F2NO2/c9-8(10)6-1-3-11(4-2-6)5-7(12)13/h6,8H,1-5H2,(H,12,13) |
| InChIKey | VYDBWVPGLPVSMA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |