C11H5BrO2 — CID 121217756
6-bromo-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-3-one (PubChem CID 121217756) has the molecular formula C11H5BrO2 and a molecular weight of 249.06 g/mol. Its IUPAC name is 6-bromo-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-3-one.
| Compound Name | 6-bromo-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-3-one |
|---|---|
| PubChem CID | 121217756 |
| Molecular Formula | C11H5BrO2 |
| Molecular Weight | 249.06 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 6-bromo-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-3-one |
| SMILES | O=C1Oc2cccc3cc(Br)cc1c23 |
| InChI | InChI=1S/C11H5BrO2/c12-7-4-6-2-1-3-9-10(6)8(5-7)11(13)14-9/h1-5H |
| InChIKey | RCLQWIKIWOMVGZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.06 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|