C11H21N3O3 — CID 121220092
(6Z)-6-(carbamoylhydrazinylidene)-3,7-dimethyloctanoic acid (PubChem CID 121220092) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is (6Z)-6-(carbamoylhydrazinylidene)-3,7-dimethyloctanoic acid.
| Compound Name | (6Z)-6-(carbamoylhydrazinylidene)-3,7-dimethyloctanoic acid |
|---|---|
| PubChem CID | 121220092 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (6Z)-6-(carbamoylhydrazinylidene)-3,7-dimethyloctanoic acid |
| SMILES | CC(CC/C(=N/NC(N)=O)C(C)C)CC(=O)O |
| InChI | InChI=1S/C11H21N3O3/c1-7(2)9(13-14-11(12)17)5-4-8(3)6-10(15)16/h7-8H,4-6H2,1-3H3,(H,15,16)(H3,12,14,17)/b13-9- |
| InChIKey | JMLPWGRLSVXGGU-LCYFTJDESA-N |
| XLogP | 1.56 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|