About 3-methylicosanedioic acid
3-methylicosanedioic acid (PubChem CID 87117627) has the molecular formula C21H40O4
and a molecular weight of 356.55 g/mol. Its IUPAC name is 3-methylicosanedioic acid.
Molecular Properties
| Compound Name | 3-methylicosanedioic acid |
| PubChem CID | 87117627 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 3-methylicosanedioic acid |
| SMILES | CC(CCCCCCCCCCCCCCCCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C21H40O4/c1-19(18-21(24)25)16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-20(22)23/h19H,2-18H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | IVHUUAOYYCXYAZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylicosanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylicosanedioic acid?
The IUPAC name of 3-methylicosanedioic acid (CID 87117627) is 3-methylicosanedioic acid.
What is the SMILES notation for 3-methylicosanedioic acid?
The canonical SMILES for 3-methylicosanedioic acid is CC(CCCCCCCCCCCCCCCCC(=O)O)CC(=O)O.
What is the InChIKey of 3-methylicosanedioic acid?
The InChIKey is IVHUUAOYYCXYAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O4/c1-19(18-21(24)25)16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-20(22)23/h19H,2-18H2,1H3,(H,22,23)(H,24,25).
What are the key properties of 3-methylicosanedioic acid?
3-methylicosanedioic acid has a molecular weight of 356.55 g/mol, XLogP of 6.42, 19 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylicosanedioic acid is sourced from PubChem (CID 87117627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).