About [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene
[(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene (PubChem CID 121220126) has the molecular formula C11H11I
and a molecular weight of 270.11 g/mol. Its IUPAC name is [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene.
Molecular Properties
| Compound Name | [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene |
| PubChem CID | 121220126 |
| Molecular Formula | C11H11I |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene |
| SMILES | C=C/C(=C/c1ccccc1)CI |
| InChI | InChI=1S/C11H11I/c1-2-10(9-12)8-11-6-4-3-5-7-11/h2-8H,1,9H2/b10-8- |
| InChIKey | MDKXVBMVMZKUOS-NTMALXAHSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene?
The IUPAC name of [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene (CID 121220126) is [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene.
What is the SMILES notation for [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene?
The canonical SMILES for [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene is C=C/C(=C/c1ccccc1)CI.
What is the InChIKey of [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene?
The InChIKey is MDKXVBMVMZKUOS-NTMALXAHSA-N. The full InChI is InChI=1S/C11H11I/c1-2-10(9-12)8-11-6-4-3-5-7-11/h2-8H,1,9H2/b10-8-.
What are the key properties of [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene?
[(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene has a molecular weight of 270.11 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z)-2-(iodomethyl)buta-1,3-dienyl]benzene is sourced from PubChem (CID 121220126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).