C11H12N2O4S — CID 121221507
1,1-dioxo-2-phenacyl-1,3,4-thiadiazinan-5-one (PubChem CID 121221507) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 1,1-dioxo-2-phenacyl-1,3,4-thiadiazinan-5-one.
| Compound Name | 1,1-dioxo-2-phenacyl-1,3,4-thiadiazinan-5-one |
|---|---|
| PubChem CID | 121221507 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1,1-dioxo-2-phenacyl-1,3,4-thiadiazinan-5-one |
| SMILES | O=C1CS(=O)(=O)C(CC(=O)c2ccccc2)NN1 |
| InChI | InChI=1S/C11H12N2O4S/c14-9(8-4-2-1-3-5-8)6-11-13-12-10(15)7-18(11,16)17/h1-5,11,13H,6-7H2,(H,12,15) |
| InChIKey | NRLKQUBHKUJLDC-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |