C11H14N2 — CID 121221564
(1E,3E)-N,N-dimethyl-4-pyridin-4-ylbuta-1,3-dien-1-amine (PubChem CID 121221564) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (1E,3E)-N,N-dimethyl-4-pyridin-4-ylbuta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-N,N-dimethyl-4-pyridin-4-ylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 121221564 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (1E,3E)-N,N-dimethyl-4-pyridin-4-ylbuta-1,3-dien-1-amine |
| SMILES | CN(C)/C=C/C=C/c1ccncc1 |
| InChI | InChI=1S/C11H14N2/c1-13(2)10-4-3-5-11-6-8-12-9-7-11/h3-10H,1-2H3/b5-3+,10-4+ |
| InChIKey | JKQCYJQFBHHCMR-OXWOXFIQSA-N |
| XLogP | 2.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|