C13H17N — CID 11586416
4-[(1E,3E)-5,5-dimethylhexa-1,3-dienyl]pyridine (PubChem CID 11586416) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 4-[(1E,3E)-5,5-dimethylhexa-1,3-dienyl]pyridine.
| Compound Name | 4-[(1E,3E)-5,5-dimethylhexa-1,3-dienyl]pyridine |
|---|---|
| PubChem CID | 11586416 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 4-[(1E,3E)-5,5-dimethylhexa-1,3-dienyl]pyridine |
| SMILES | CC(C)(C)/C=C/C=C/c1ccncc1 |
| InChI | InChI=1S/C13H17N/c1-13(2,3)9-5-4-6-12-7-10-14-11-8-12/h4-11H,1-3H3/b6-4+,9-5+ |
| InChIKey | RCTVYGRDSPWOIF-REZHQCRGSA-N |
| XLogP | 3.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|