C16H12Y2-2 — CID 59968237
[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene;bis(yttrium) (PubChem CID 59968237) has the molecular formula C16H12Y2-2 and a molecular weight of 382.08 g/mol. Its IUPAC name is [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene;bis(yttrium).
| Compound Name | [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene;bis(yttrium) |
|---|---|
| PubChem CID | 59968237 |
| Molecular Formula | C16H12Y2-2 |
| Molecular Weight | 382.08 g/mol |
| Exact Mass | 381.91 |
| IUPAC Name | [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene;bis(yttrium) |
| SMILES | [Y].[Y].[c-]1ccc(/C=C/C=C/c2cc[c-]cc2)cc1 |
| InChI | InChI=1S/C16H12.2Y/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;;/h3-14H;;/q-2;;/b13-7+,14-8+;; |
| InChIKey | KFBMDZAPMQPBHH-SOUIOMOHSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.08 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|