About S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate
S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate (PubChem CID 121221682) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate.
Molecular Properties
| Compound Name | S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate |
| PubChem CID | 121221682 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate |
| SMILES | CCSC(=O)C[C@H](C)CCC#CCO |
| InChI | InChI=1S/C11H18O2S/c1-3-14-11(13)9-10(2)7-5-4-6-8-12/h10,12H,3,5,7-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | DMJKNCQECKPSEA-SNVBAGLBSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate?
The IUPAC name of S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate (CID 121221682) is S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate.
What is the SMILES notation for S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate?
The canonical SMILES for S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate is CCSC(=O)C[C@H](C)CCC#CCO.
What is the InChIKey of S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate?
The InChIKey is DMJKNCQECKPSEA-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H18O2S/c1-3-14-11(13)9-10(2)7-5-4-6-8-12/h10,12H,3,5,7-9H2,1-2H3/t10-/m1/s1.
What are the key properties of S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate?
S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate has a molecular weight of 214.33 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (3R)-8-hydroxy-3-methyloct-6-ynethioate is sourced from PubChem (CID 121221682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).