C11H14N2O2 — CID 121223465
3-hydroxy-2,4-dimethyl-1-oxido-5-phenyl-2,4-dihydroimidazol-1-ium (PubChem CID 121223465) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-hydroxy-2,4-dimethyl-1-oxido-5-phenyl-2,4-dihydroimidazol-1-ium.
| Compound Name | 3-hydroxy-2,4-dimethyl-1-oxido-5-phenyl-2,4-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 121223465 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-hydroxy-2,4-dimethyl-1-oxido-5-phenyl-2,4-dihydroimidazol-1-ium |
| SMILES | CC1C(c2ccccc2)=[N+]([O-])C(C)N1O |
| InChI | InChI=1S/C11H14N2O2/c1-8-11(10-6-4-3-5-7-10)13(15)9(2)12(8)14/h3-9,14H,1-2H3 |
| InChIKey | MYBCRLOBNCOIIX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|