C16H12F3N3OPd — CID 121225893
acetonitrile;palladium(2+);pyridine-2-carbonyl-[[2-(trifluoromethyl)benzene-6-id-1-yl]methyl]azanide (PubChem CID 121225893) has the molecular formula C16H12F3N3OPd and a molecular weight of 425.71 g/mol. Its IUPAC name is acetonitrile;palladium(2+);pyridine-2-carbonyl-[[2-(trifluoromethyl)benzene-6-id-1-yl]methyl]azanide.
| Compound Name | acetonitrile;palladium(2+);pyridine-2-carbonyl-[[2-(trifluoromethyl)benzene-6-id-1-yl]methyl]azanide |
|---|---|
| PubChem CID | 121225893 |
| Molecular Formula | C16H12F3N3OPd |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | acetonitrile;palladium(2+);pyridine-2-carbonyl-[[2-(trifluoromethyl)benzene-6-id-1-yl]methyl]azanide |
| SMILES | CC#N.O=C([N-]Cc1[c-]cccc1C(F)(F)F)c1ccccn1.[Pd+2] |
| InChI | InChI=1S/C14H10F3N2O.C2H3N.Pd/c15-14(16,17)11-6-2-1-5-10(11)9-19-13(20)12-7-3-4-8-18-12;1-2-3;/h1-4,6-8H,9H2,(H,19,20);1H3;/q-1;;+2/p-1 |
| InChIKey | PPEUSXBTYYDJRZ-UHFFFAOYSA-M |
| XLogP | 4.14 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|