C9H6Cl2F2O2 — CID 121228158
1-[2,6-dichloro-4-(difluoromethoxy)phenyl]ethanone (PubChem CID 121228158) has the molecular formula C9H6Cl2F2O2 and a molecular weight of 255.05 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(difluoromethoxy)phenyl]ethanone.
| Compound Name | 1-[2,6-dichloro-4-(difluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 121228158 |
| Molecular Formula | C9H6Cl2F2O2 |
| Molecular Weight | 255.05 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 1-[2,6-dichloro-4-(difluoromethoxy)phenyl]ethanone |
| SMILES | CC(=O)c1c(Cl)cc(OC(F)F)cc1Cl |
| InChI | InChI=1S/C9H6Cl2F2O2/c1-4(14)8-6(10)2-5(3-7(8)11)15-9(12)13/h2-3,9H,1H3 |
| InChIKey | XRYSYFGJNBQDNQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.05 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |