C7H3BrCl2F2O — CID 171032891
2-bromo-1,3-dichloro-5-(difluoromethoxy)benzene (PubChem CID 171032891) has the molecular formula C7H3BrCl2F2O and a molecular weight of 291.91 g/mol. Its IUPAC name is 2-bromo-1,3-dichloro-5-(difluoromethoxy)benzene.
| Compound Name | 2-bromo-1,3-dichloro-5-(difluoromethoxy)benzene |
|---|---|
| PubChem CID | 171032891 |
| Molecular Formula | C7H3BrCl2F2O |
| Molecular Weight | 291.91 g/mol |
| Exact Mass | 289.87 |
| IUPAC Name | 2-bromo-1,3-dichloro-5-(difluoromethoxy)benzene |
| SMILES | FC(F)Oc1cc(Cl)c(Br)c(Cl)c1 |
| InChI | InChI=1S/C7H3BrCl2F2O/c8-6-4(9)1-3(2-5(6)10)13-7(11)12/h1-2,7H |
| InChIKey | YDWJGUXXLWDAPJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|