C25H19F2NO8 — CID 121231518
2',7'-difluoro-3',6'-dihydroxy-N-[2-(2-hydroxyethoxy)ethyl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide (PubChem CID 121231518) has the molecular formula C25H19F2NO8 and a molecular weight of 499.42 g/mol. Its IUPAC name is 2',7'-difluoro-3',6'-dihydroxy-N-[2-(2-hydroxyethoxy)ethyl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide.
| Compound Name | 2',7'-difluoro-3',6'-dihydroxy-N-[2-(2-hydroxyethoxy)ethyl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 121231518 |
| Molecular Formula | C25H19F2NO8 |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2',7'-difluoro-3',6'-dihydroxy-N-[2-(2-hydroxyethoxy)ethyl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
| SMILES | O=C(NCCOCCO)c1ccc2c(c1)C(=O)OC21c2cc(F)c(O)cc2Oc2cc(O)c(F)cc21 |
| InChI | InChI=1S/C25H19F2NO8/c26-17-8-15-21(10-19(17)30)35-22-11-20(31)18(27)9-16(22)25(15)14-2-1-12(7-13(14)24(33)36-25)23(32)28-3-5-34-6-4-29/h1-2,7-11,29-31H,3-6H2,(H,28,32) |
| InChIKey | XRZKNBNMRSAIPH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|