About aziridine;3-chloropropyl(trimethoxy)silane
aziridine;3-chloropropyl(trimethoxy)silane (PubChem CID 121233192) has the molecular formula C8H20ClNO3Si
and a molecular weight of 241.79 g/mol. Its IUPAC name is aziridine;3-chloropropyl(trimethoxy)silane.
Molecular Properties
| Compound Name | aziridine;3-chloropropyl(trimethoxy)silane |
| PubChem CID | 121233192 |
| Molecular Formula | C8H20ClNO3Si |
| Molecular Weight | 241.79 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | aziridine;3-chloropropyl(trimethoxy)silane |
| SMILES | C1CN1.CO[Si](CCCCl)(OC)OC |
| InChI | InChI=1S/C6H15ClO3Si.C2H5N/c1-8-11(9-2,10-3)6-4-5-7;1-2-3-1/h4-6H2,1-3H3;3H,1-2H2 |
| InChIKey | OEZXOWPAXNFLEK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.79 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridine;3-chloropropyl(trimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridine;3-chloropropyl(trimethoxy)silane?
The IUPAC name of aziridine;3-chloropropyl(trimethoxy)silane (CID 121233192) is aziridine;3-chloropropyl(trimethoxy)silane.
What is the SMILES notation for aziridine;3-chloropropyl(trimethoxy)silane?
The canonical SMILES for aziridine;3-chloropropyl(trimethoxy)silane is C1CN1.CO[Si](CCCCl)(OC)OC.
What is the InChIKey of aziridine;3-chloropropyl(trimethoxy)silane?
The InChIKey is OEZXOWPAXNFLEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15ClO3Si.C2H5N/c1-8-11(9-2,10-3)6-4-5-7;1-2-3-1/h4-6H2,1-3H3;3H,1-2H2.
What are the key properties of aziridine;3-chloropropyl(trimethoxy)silane?
aziridine;3-chloropropyl(trimethoxy)silane has a molecular weight of 241.79 g/mol, XLogP of 1.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aziridine;3-chloropropyl(trimethoxy)silane is sourced from PubChem (CID 121233192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).