C30H67ClN2O8Si2 — CID 165068627
8-chlorooctyl(trimethoxy)silane;morpholine;trimethoxy(8-morpholin-4-yloctyl)silane (PubChem CID 165068627) has the molecular formula C30H67ClN2O8Si2 and a molecular weight of 675.50 g/mol. Its IUPAC name is 8-chlorooctyl(trimethoxy)silane;morpholine;trimethoxy(8-morpholin-4-yloctyl)silane.
| Compound Name | 8-chlorooctyl(trimethoxy)silane;morpholine;trimethoxy(8-morpholin-4-yloctyl)silane |
|---|---|
| PubChem CID | 165068627 |
| Molecular Formula | C30H67ClN2O8Si2 |
| Molecular Weight | 675.50 g/mol |
| Exact Mass | 674.41 |
| IUPAC Name | 8-chlorooctyl(trimethoxy)silane;morpholine;trimethoxy(8-morpholin-4-yloctyl)silane |
| SMILES | C1COCCN1.CO[Si](CCCCCCCCCl)(OC)OC.CO[Si](CCCCCCCCN1CCOCC1)(OC)OC |
| InChI | InChI=1S/C15H33NO4Si.C11H25ClO3Si.C4H9NO/c1-17-21(18-2,19-3)15-9-7-5-4-6-8-10-16-11-13-20-14-12-16;1-13-16(14-2,15-3)11-9-7-5-4-6-8-10-12;1-3-6-4-2-5-1/h4-15H2,1-3H3;4-11H2,1-3H3;5H,1-4H2 |
| InChIKey | SJOQQYKGTJWGCU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|