C24H54N2O10Si2 — CID 102530971
trimethoxy-[3-[16-(3-trimethoxysilylpropyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]propyl]silane (PubChem CID 102530971) has the molecular formula C24H54N2O10Si2 and a molecular weight of 586.87 g/mol. Its IUPAC name is trimethoxy-[3-[16-(3-trimethoxysilylpropyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]propyl]silane.
| Compound Name | trimethoxy-[3-[16-(3-trimethoxysilylpropyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]propyl]silane |
|---|---|
| PubChem CID | 102530971 |
| Molecular Formula | C24H54N2O10Si2 |
| Molecular Weight | 586.87 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | trimethoxy-[3-[16-(3-trimethoxysilylpropyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]propyl]silane |
| SMILES | CO[Si](CCCN1CCOCCOCCN(CCC[Si](OC)(OC)OC)CCOCCOCC1)(OC)OC |
| InChI | InChI=1S/C24H54N2O10Si2/c1-27-37(28-2,29-3)23-7-9-25-11-15-33-19-21-35-17-13-26(14-18-36-22-20-34-16-12-25)10-8-24-38(30-4,31-5)32-6/h7-24H2,1-6H3 |
| InChIKey | LDTNLMVHMWBDLE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 98.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.87 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|