C13H20N4 — CID 121235734
1-butyl-1-methylpyrrolidin-1-ium;2,2-dicyanoethenylideneazanide (PubChem CID 121235734) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-butyl-1-methylpyrrolidin-1-ium;2,2-dicyanoethenylideneazanide.
| Compound Name | 1-butyl-1-methylpyrrolidin-1-ium;2,2-dicyanoethenylideneazanide |
|---|---|
| PubChem CID | 121235734 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 1-butyl-1-methylpyrrolidin-1-ium;2,2-dicyanoethenylideneazanide |
| SMILES | CCCC[N+]1(C)CCCC1.N#CC(=C=[N-])C#N |
| InChI | InChI=1S/C9H20N.C4N3/c1-3-4-7-10(2)8-5-6-9-10;5-1-4(2-6)3-7/h3-9H2,1-2H3;/q+1;-1 |
| InChIKey | NSZMIQHKJOPSCZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|