C17H22F17N2P — CID 164677407
CID 164677407 (PubChem CID 164677407) has the molecular formula C17H22F17N2P and a molecular weight of 608.32 g/mol.
| Compound Name | CID 164677407 |
|---|---|
| PubChem CID | 164677407 |
| Molecular Formula | C17H22F17N2P |
| Molecular Weight | 608.32 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | — |
| SMILES | CCCC[N+]1(C)CCCC1.N#CC[P-](F)(F)(C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H20N.C8H2F17NP/c1-3-4-7-10(2)8-5-6-9-10;9-3(10,11)6(18,19)27(24,25,2-1-26,7(20,21)4(12,13)14)8(22,23)5(15,16)17/h3-9H2,1-2H3;2H2/q+1;-1 |
| InChIKey | NXINMFZWULVNFF-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.32 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|