C14H23BN4O4 — CID 173499943
1-butyl-1-methylpyrrolidin-1-ium;hydroxy(1,1,2-tricyanoethylperoxy)borinate (PubChem CID 173499943) has the molecular formula C14H23BN4O4 and a molecular weight of 322.17 g/mol. Its IUPAC name is 1-butyl-1-methylpyrrolidin-1-ium;hydroxy(1,1,2-tricyanoethylperoxy)borinate.
| Compound Name | 1-butyl-1-methylpyrrolidin-1-ium;hydroxy(1,1,2-tricyanoethylperoxy)borinate |
|---|---|
| PubChem CID | 173499943 |
| Molecular Formula | C14H23BN4O4 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-butyl-1-methylpyrrolidin-1-ium;hydroxy(1,1,2-tricyanoethylperoxy)borinate |
| SMILES | CCCC[N+]1(C)CCCC1.N#CCC(C#N)(C#N)OOB([O-])O |
| InChI | InChI=1S/C9H20N.C5H3BN3O4/c1-3-4-7-10(2)8-5-6-9-10;7-2-1-5(3-8,4-9)12-13-6(10)11/h3-9H2,1-2H3;10H,1H2/q+1;-1 |
| InChIKey | JXKYRHHHIKMNCG-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|