C16H32F6N2O4S2 — CID 121235740
bis(trifluoromethylsulfonyl)azanide;triethyl(octyl)azanium (PubChem CID 121235740) has the molecular formula C16H32F6N2O4S2 and a molecular weight of 494.56 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;triethyl(octyl)azanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;triethyl(octyl)azanium |
|---|---|
| PubChem CID | 121235740 |
| Molecular Formula | C16H32F6N2O4S2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;triethyl(octyl)azanium |
| SMILES | CCCCCCCC[N+](CC)(CC)CC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H32N.C2F6NO4S2/c1-5-9-10-11-12-13-14-15(6-2,7-3)8-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-14H2,1-4H3;/q+1;-1 |
| InChIKey | SBBLWFHKFTVQAB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|