C13H13Cl2N3 — CID 121236121
3,6-dichloro-4-piperazin-1-ylquinoline (PubChem CID 121236121) has the molecular formula C13H13Cl2N3 and a molecular weight of 282.17 g/mol. Its IUPAC name is 3,6-dichloro-4-piperazin-1-ylquinoline.
| Compound Name | 3,6-dichloro-4-piperazin-1-ylquinoline |
|---|---|
| PubChem CID | 121236121 |
| Molecular Formula | C13H13Cl2N3 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3,6-dichloro-4-piperazin-1-ylquinoline |
| SMILES | Clc1ccc2ncc(Cl)c(N3CCNCC3)c2c1 |
| InChI | InChI=1S/C13H13Cl2N3/c14-9-1-2-12-10(7-9)13(11(15)8-17-12)18-5-3-16-4-6-18/h1-2,7-8,16H,3-6H2 |
| InChIKey | YDGNDKGRCZFHNO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |