C15H19Cl2N3 — CID 121236465
3-chloro-5,8-dimethyl-4-piperazin-1-ylquinoline;hydrochloride (PubChem CID 121236465) has the molecular formula C15H19Cl2N3 and a molecular weight of 312.24 g/mol. Its IUPAC name is 3-chloro-5,8-dimethyl-4-piperazin-1-ylquinoline;hydrochloride.
| Compound Name | 3-chloro-5,8-dimethyl-4-piperazin-1-ylquinoline;hydrochloride |
|---|---|
| PubChem CID | 121236465 |
| Molecular Formula | C15H19Cl2N3 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-chloro-5,8-dimethyl-4-piperazin-1-ylquinoline;hydrochloride |
| SMILES | Cc1ccc(C)c2c(N3CCNCC3)c(Cl)cnc12.Cl |
| InChI | InChI=1S/C15H18ClN3.ClH/c1-10-3-4-11(2)14-13(10)15(12(16)9-18-14)19-7-5-17-6-8-19;/h3-4,9,17H,5-8H2,1-2H3;1H |
| InChIKey | ILBMHVCRAJDHTD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |