C17H24ClN3 — CID 121236555
3-ethyl-7,8-dimethyl-2-piperazin-1-ylquinoline;hydrochloride (PubChem CID 121236555) has the molecular formula C17H24ClN3 and a molecular weight of 305.85 g/mol. Its IUPAC name is 3-ethyl-7,8-dimethyl-2-piperazin-1-ylquinoline;hydrochloride.
| Compound Name | 3-ethyl-7,8-dimethyl-2-piperazin-1-ylquinoline;hydrochloride |
|---|---|
| PubChem CID | 121236555 |
| Molecular Formula | C17H24ClN3 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-ethyl-7,8-dimethyl-2-piperazin-1-ylquinoline;hydrochloride |
| SMILES | CCc1cc2ccc(C)c(C)c2nc1N1CCNCC1.Cl |
| InChI | InChI=1S/C17H23N3.ClH/c1-4-14-11-15-6-5-12(2)13(3)16(15)19-17(14)20-9-7-18-8-10-20;/h5-6,11,18H,4,7-10H2,1-3H3;1H |
| InChIKey | VTYYMJUNEJDQPY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |