C23H24N4O4 — CID 121239049
2-[1-(2-methoxyethyl)indol-4-yl]oxy-N-[2-(4-oxoquinazolin-3-yl)ethyl]acetamide (PubChem CID 121239049) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[1-(2-methoxyethyl)indol-4-yl]oxy-N-[2-(4-oxoquinazolin-3-yl)ethyl]acetamide.
| Compound Name | 2-[1-(2-methoxyethyl)indol-4-yl]oxy-N-[2-(4-oxoquinazolin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 121239049 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[1-(2-methoxyethyl)indol-4-yl]oxy-N-[2-(4-oxoquinazolin-3-yl)ethyl]acetamide |
| SMILES | COCCn1ccc2c(OCC(=O)NCCn3cnc4ccccc4c3=O)cccc21 |
| InChI | InChI=1S/C23H24N4O4/c1-30-14-13-26-11-9-18-20(26)7-4-8-21(18)31-15-22(28)24-10-12-27-16-25-19-6-3-2-5-17(19)23(27)29/h2-9,11,16H,10,12-15H2,1H3,(H,24,28) |
| InChIKey | HAIBMCDSFQURRX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |