C26H31N3O3 — CID 121240182
2-[1-(2-methoxyethyl)indol-4-yl]oxy-N-[1-(3-methylbutyl)indol-5-yl]acetamide (PubChem CID 121240182) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[1-(2-methoxyethyl)indol-4-yl]oxy-N-[1-(3-methylbutyl)indol-5-yl]acetamide.
| Compound Name | 2-[1-(2-methoxyethyl)indol-4-yl]oxy-N-[1-(3-methylbutyl)indol-5-yl]acetamide |
|---|---|
| PubChem CID | 121240182 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[1-(2-methoxyethyl)indol-4-yl]oxy-N-[1-(3-methylbutyl)indol-5-yl]acetamide |
| SMILES | COCCn1ccc2c(OCC(=O)Nc3ccc4c(ccn4CCC(C)C)c3)cccc21 |
| InChI | InChI=1S/C26H31N3O3/c1-19(2)9-12-28-13-10-20-17-21(7-8-23(20)28)27-26(30)18-32-25-6-4-5-24-22(25)11-14-29(24)15-16-31-3/h4-8,10-11,13-14,17,19H,9,12,15-16,18H2,1-3H3,(H,27,30) |
| InChIKey | HIEBUYNRQJNQRR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |