C27H30N4O4 — CID 167911759
1-N,2-N-bis[1-(2-methoxyethyl)indol-5-yl]cyclopropane-1,2-dicarboxamide (PubChem CID 167911759) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 1-N,2-N-bis[1-(2-methoxyethyl)indol-5-yl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis[1-(2-methoxyethyl)indol-5-yl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 167911759 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1-N,2-N-bis[1-(2-methoxyethyl)indol-5-yl]cyclopropane-1,2-dicarboxamide |
| SMILES | COCCn1ccc2cc(NC(=O)C3CC3C(=O)Nc3ccc4c(ccn4CCOC)c3)ccc21 |
| InChI | InChI=1S/C27H30N4O4/c1-34-13-11-30-9-7-18-15-20(3-5-24(18)30)28-26(32)22-17-23(22)27(33)29-21-4-6-25-19(16-21)8-10-31(25)12-14-35-2/h3-10,15-16,22-23H,11-14,17H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | FWYJDUKTQKRCBW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |