C16H16N4O3 — CID 51101816
N-[1-(2-methoxyethyl)indol-5-yl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 51101816) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)indol-5-yl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[1-(2-methoxyethyl)indol-5-yl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 51101816 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-[1-(2-methoxyethyl)indol-5-yl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | COCCn1ccc2cc(NC(=O)c3ccc(=O)[nH]n3)ccc21 |
| InChI | InChI=1S/C16H16N4O3/c1-23-9-8-20-7-6-11-10-12(2-4-14(11)20)17-16(22)13-3-5-15(21)19-18-13/h2-7,10H,8-9H2,1H3,(H,17,22)(H,19,21) |
| InChIKey | OQLYBRKJVJRDOI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |