C26H13F3O6S — CID 121242466
(3-dibenzofuran-1-yl-6-oxobenzo[c]chromen-8-yl) trifluoromethanesulfonate (PubChem CID 121242466) has the molecular formula C26H13F3O6S and a molecular weight of 510.45 g/mol. Its IUPAC name is (3-dibenzofuran-1-yl-6-oxobenzo[c]chromen-8-yl) trifluoromethanesulfonate.
| Compound Name | (3-dibenzofuran-1-yl-6-oxobenzo[c]chromen-8-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 121242466 |
| Molecular Formula | C26H13F3O6S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | (3-dibenzofuran-1-yl-6-oxobenzo[c]chromen-8-yl) trifluoromethanesulfonate |
| SMILES | O=c1oc2cc(-c3cccc4oc5ccccc5c34)ccc2c2ccc(OS(=O)(=O)C(F)(F)F)cc12 |
| InChI | InChI=1S/C26H13F3O6S/c27-26(28,29)36(31,32)35-15-9-11-17-18-10-8-14(12-23(18)34-25(30)20(17)13-15)16-5-3-7-22-24(16)19-4-1-2-6-21(19)33-22/h1-13H |
| InChIKey | APCGXQHHGQHFCU-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|