C29H15F3O4S — CID 166723826
27-oxaheptacyclo[16.11.0.02,11.03,8.012,17.020,28.021,26]nonacosa-1(29),2(11),3,5,7,9,12,14,16,18,20(28),21,23,25-tetradecaen-9-yl trifluoromethanesulfonate (PubChem CID 166723826) has the molecular formula C29H15F3O4S and a molecular weight of 516.50 g/mol. Its IUPAC name is 27-oxaheptacyclo[16.11.0.02,11.03,8.012,17.020,28.021,26]nonacosa-1(29),2(11),3,5,7,9,12,14,16,18,20(28),21,23,25-tetradecaen-9-yl trifluoromethanesulfonate.
| Compound Name | 27-oxaheptacyclo[16.11.0.02,11.03,8.012,17.020,28.021,26]nonacosa-1(29),2(11),3,5,7,9,12,14,16,18,20(28),21,23,25-tetradecaen-9-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166723826 |
| Molecular Formula | C29H15F3O4S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | 27-oxaheptacyclo[16.11.0.02,11.03,8.012,17.020,28.021,26]nonacosa-1(29),2(11),3,5,7,9,12,14,16,18,20(28),21,23,25-tetradecaen-9-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c3ccccc3c3cc4c(cc3c2c2ccccc12)oc1ccccc14)C(F)(F)F |
| InChI | InChI=1S/C29H15F3O4S/c30-29(31,32)37(33,34)36-27-15-23-17-8-2-1-7-16(17)21-13-22-19-10-5-6-12-25(19)35-26(22)14-24(21)28(23)20-11-4-3-9-18(20)27/h1-15H |
| InChIKey | NDDQXSJJDGSAKU-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|