C28H24F3NO4S — CID 88866086
[4-(dibenzofuran-2-ylmethyl)-6,7-dimethyl-1-propylisoquinolin-3-yl] trifluoromethanesulfonate (PubChem CID 88866086) has the molecular formula C28H24F3NO4S and a molecular weight of 527.56 g/mol. Its IUPAC name is [4-(dibenzofuran-2-ylmethyl)-6,7-dimethyl-1-propylisoquinolin-3-yl] trifluoromethanesulfonate.
| Compound Name | [4-(dibenzofuran-2-ylmethyl)-6,7-dimethyl-1-propylisoquinolin-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88866086 |
| Molecular Formula | C28H24F3NO4S |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | [4-(dibenzofuran-2-ylmethyl)-6,7-dimethyl-1-propylisoquinolin-3-yl] trifluoromethanesulfonate |
| SMILES | CCCc1nc(OS(=O)(=O)C(F)(F)F)c(Cc2ccc3oc4ccccc4c3c2)c2cc(C)c(C)cc12 |
| InChI | InChI=1S/C28H24F3NO4S/c1-4-7-24-21-13-17(3)16(2)12-20(21)23(27(32-24)36-37(33,34)28(29,30)31)15-18-10-11-26-22(14-18)19-8-5-6-9-25(19)35-26/h5-6,8-14H,4,7,15H2,1-3H3 |
| InChIKey | VELJDTATIHPUPG-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|