C24H19F3O4S — CID 134393203
(12,12-diethylfluoreno[2,1-b][1]benzofuran-7-yl) trifluoromethanesulfonate (PubChem CID 134393203) has the molecular formula C24H19F3O4S and a molecular weight of 460.47 g/mol. Its IUPAC name is (12,12-diethylfluoreno[2,1-b][1]benzofuran-7-yl) trifluoromethanesulfonate.
| Compound Name | (12,12-diethylfluoreno[2,1-b][1]benzofuran-7-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134393203 |
| Molecular Formula | C24H19F3O4S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (12,12-diethylfluoreno[2,1-b][1]benzofuran-7-yl) trifluoromethanesulfonate |
| SMILES | CCC1(CC)c2ccccc2-c2c(OS(=O)(=O)C(F)(F)F)cc3oc4ccccc4c3c21 |
| InChI | InChI=1S/C24H19F3O4S/c1-3-23(4-2)16-11-7-5-9-14(16)20-19(31-32(28,29)24(25,26)27)13-18-21(22(20)23)15-10-6-8-12-17(15)30-18/h5-13H,3-4H2,1-2H3 |
| InChIKey | KTCMGIAOKYHZEK-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|