C37H21F9O3S — CID 139576857
(9,9-diphenyl-7-pentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),2(10),3(8),4,6,11,14,16,18,20-decaenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139576857) has the molecular formula C37H21F9O3S and a molecular weight of 716.62 g/mol. Its IUPAC name is (9,9-diphenyl-7-pentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),2(10),3(8),4,6,11,14,16,18,20-decaenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (9,9-diphenyl-7-pentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),2(10),3(8),4,6,11,14,16,18,20-decaenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139576857 |
| Molecular Formula | C37H21F9O3S |
| Molecular Weight | 716.62 g/mol |
| Exact Mass | 716.11 |
| IUPAC Name | (9,9-diphenyl-7-pentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),2(10),3(8),4,6,11,14,16,18,20-decaenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1cccc2c1C(c1ccccc1)(c1ccccc1)c1ccc3ccc4ccccc4c3c1-2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C37H21F9O3S/c38-34(39,36(42,43)44)35(40,41)37(45,46)50(47,48)49-29-17-9-16-27-31-28(21-20-23-19-18-22-10-7-8-15-26(22)30(23)31)33(32(27)29,24-11-3-1-4-12-24)25-13-5-2-6-14-25/h1-21H |
| InChIKey | RJOMGJAVOTXQPT-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.62 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|