About 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole
9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole (PubChem CID 121245443) has the molecular formula C32H24N3OP
and a molecular weight of 497.54 g/mol. Its IUPAC name is 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole.
Molecular Properties
| Compound Name | 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole |
| PubChem CID | 121245443 |
| Molecular Formula | C32H24N3OP |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole |
| SMILES | C=Cc1ccc2c(c1)c1cc(C=C)ccc1n2-c1cnc(P(=O)(c2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C32H24N3OP/c1-3-23-15-17-30-28(19-23)29-20-24(4-2)16-18-31(29)35(30)25-21-33-32(34-22-25)37(36,26-11-7-5-8-12-26)27-13-9-6-10-14-27/h3-22H,1-2H2 |
| InChIKey | BAQBUYLLMPLGHX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole?
The IUPAC name of 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole (CID 121245443) is 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole.
What is the SMILES notation for 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole?
The canonical SMILES for 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole is C=Cc1ccc2c(c1)c1cc(C=C)ccc1n2-c1cnc(P(=O)(c2ccccc2)c2ccccc2)nc1.
What is the InChIKey of 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole?
The InChIKey is BAQBUYLLMPLGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H24N3OP/c1-3-23-15-17-30-28(19-23)29-20-24(4-2)16-18-31(29)35(30)25-21-33-32(34-22-25)37(36,26-11-7-5-8-12-26)27-13-9-6-10-14-27/h3-22H,1-2H2.
What are the key properties of 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole?
9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole has a molecular weight of 497.54 g/mol, XLogP of 6.50, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2-diphenylphosphorylpyrimidin-5-yl)-3,6-bis(ethenyl)carbazole is sourced from PubChem (CID 121245443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).