C9H16INO3 — CID 121246888
[1-(2-hydroxyacetyl)-3,3-dimethylpiperidin-4-yl] hypoiodite (PubChem CID 121246888) has the molecular formula C9H16INO3 and a molecular weight of 313.14 g/mol. Its IUPAC name is [1-(2-hydroxyacetyl)-3,3-dimethylpiperidin-4-yl] hypoiodite.
| Compound Name | [1-(2-hydroxyacetyl)-3,3-dimethylpiperidin-4-yl] hypoiodite |
|---|---|
| PubChem CID | 121246888 |
| Molecular Formula | C9H16INO3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | [1-(2-hydroxyacetyl)-3,3-dimethylpiperidin-4-yl] hypoiodite |
| SMILES | CC1(C)CN(C(=O)CO)CCC1OI |
| InChI | InChI=1S/C9H16INO3/c1-9(2)6-11(8(13)5-12)4-3-7(9)14-10/h7,12H,3-6H2,1-2H3 |
| InChIKey | NTJNYOSZBXZWDV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|