C24H22FN5O4 — CID 121250009
tert-butyl N-[[2-fluoro-4-[2-(3-nitrophenyl)-1H-imidazo[4,5-b]pyridin-7-yl]phenyl]methyl]carbamate (PubChem CID 121250009) has the molecular formula C24H22FN5O4 and a molecular weight of 463.47 g/mol. Its IUPAC name is tert-butyl N-[[2-fluoro-4-[2-(3-nitrophenyl)-1H-imidazo[4,5-b]pyridin-7-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-fluoro-4-[2-(3-nitrophenyl)-1H-imidazo[4,5-b]pyridin-7-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 121250009 |
| Molecular Formula | C24H22FN5O4 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | tert-butyl N-[[2-fluoro-4-[2-(3-nitrophenyl)-1H-imidazo[4,5-b]pyridin-7-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(-c2ccnc3nc(-c4cccc([N+](=O)[O-])c4)[nH]c23)cc1F |
| InChI | InChI=1S/C24H22FN5O4/c1-24(2,3)34-23(31)27-13-16-8-7-14(12-19(16)25)18-9-10-26-22-20(18)28-21(29-22)15-5-4-6-17(11-15)30(32)33/h4-12H,13H2,1-3H3,(H,27,31)(H,26,28,29) |
| InChIKey | KGGKJFBGBCYNIM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|