C27H23N7O — CID 121259134
3-amino-N-[(1R)-1-[7-[2-(1-methylpyrazol-4-yl)ethynyl]-1-phenylindol-2-yl]ethyl]pyrazine-2-carboxamide (PubChem CID 121259134) has the molecular formula C27H23N7O and a molecular weight of 461.53 g/mol. Its IUPAC name is 3-amino-N-[(1R)-1-[7-[2-(1-methylpyrazol-4-yl)ethynyl]-1-phenylindol-2-yl]ethyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(1R)-1-[7-[2-(1-methylpyrazol-4-yl)ethynyl]-1-phenylindol-2-yl]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 121259134 |
| Molecular Formula | C27H23N7O |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 3-amino-N-[(1R)-1-[7-[2-(1-methylpyrazol-4-yl)ethynyl]-1-phenylindol-2-yl]ethyl]pyrazine-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nccnc1N)c1cc2cccc(C#Cc3cnn(C)c3)c2n1-c1ccccc1 |
| InChI | InChI=1S/C27H23N7O/c1-18(32-27(35)24-26(28)30-14-13-29-24)23-15-21-8-6-7-20(12-11-19-16-31-33(2)17-19)25(21)34(23)22-9-4-3-5-10-22/h3-10,13-18H,1-2H3,(H2,28,30)(H,32,35)/t18-/m1/s1 |
| InChIKey | INZRJAQJTXAAMH-GOSISDBHSA-N |
| XLogP | 3.63 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|