C31H25N7O — CID 121259132
7-amino-N-[(1R)-1-[7-[2-(1-methylpyrazol-4-yl)ethynyl]-1-phenylindol-2-yl]ethyl]-1,6-naphthyridine-8-carboxamide (PubChem CID 121259132) has the molecular formula C31H25N7O and a molecular weight of 511.59 g/mol. Its IUPAC name is 7-amino-N-[(1R)-1-[7-[2-(1-methylpyrazol-4-yl)ethynyl]-1-phenylindol-2-yl]ethyl]-1,6-naphthyridine-8-carboxamide.
| Compound Name | 7-amino-N-[(1R)-1-[7-[2-(1-methylpyrazol-4-yl)ethynyl]-1-phenylindol-2-yl]ethyl]-1,6-naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 121259132 |
| Molecular Formula | C31H25N7O |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 7-amino-N-[(1R)-1-[7-[2-(1-methylpyrazol-4-yl)ethynyl]-1-phenylindol-2-yl]ethyl]-1,6-naphthyridine-8-carboxamide |
| SMILES | C[C@@H](NC(=O)c1c(N)ncc2cccnc12)c1cc2cccc(C#Cc3cnn(C)c3)c2n1-c1ccccc1 |
| InChI | InChI=1S/C31H25N7O/c1-20(36-31(39)27-28-24(10-7-15-33-28)18-34-30(27)32)26-16-23-9-6-8-22(14-13-21-17-35-37(2)19-21)29(23)38(26)25-11-4-3-5-12-25/h3-12,15-20H,1-2H3,(H2,32,34)(H,36,39)/t20-/m1/s1 |
| InChIKey | YNEAJNUAEAUONP-HXUWFJFHSA-N |
| XLogP | 4.78 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|