C12H22FNO2 — CID 121261810
(3R,4S)-3-fluoro-1-(oxolan-3-yl)-4-propan-2-yloxypiperidine (PubChem CID 121261810) has the molecular formula C12H22FNO2 and a molecular weight of 231.31 g/mol. Its IUPAC name is (3R,4S)-3-fluoro-1-(oxolan-3-yl)-4-propan-2-yloxypiperidine.
| Compound Name | (3R,4S)-3-fluoro-1-(oxolan-3-yl)-4-propan-2-yloxypiperidine |
|---|---|
| PubChem CID | 121261810 |
| Molecular Formula | C12H22FNO2 |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (3R,4S)-3-fluoro-1-(oxolan-3-yl)-4-propan-2-yloxypiperidine |
| SMILES | CC(C)O[C@H]1CCN(C2CCOC2)C[C@H]1F |
| InChI | InChI=1S/C12H22FNO2/c1-9(2)16-12-3-5-14(7-11(12)13)10-4-6-15-8-10/h9-12H,3-8H2,1-2H3/t10?,11-,12+/m1/s1 |
| InChIKey | NUBFSJZKXDGHFT-SAIIYOCFSA-N |
| XLogP | 1.61 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |