C15H17N5 — CID 121262387
4-[(4-aminocyclohexyl)amino]quinazoline-6-carbonitrile (PubChem CID 121262387) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)amino]quinazoline-6-carbonitrile.
| Compound Name | 4-[(4-aminocyclohexyl)amino]quinazoline-6-carbonitrile |
|---|---|
| PubChem CID | 121262387 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[(4-aminocyclohexyl)amino]quinazoline-6-carbonitrile |
| SMILES | N#Cc1ccc2ncnc(NC3CCC(N)CC3)c2c1 |
| InChI | InChI=1S/C15H17N5/c16-8-10-1-6-14-13(7-10)15(19-9-18-14)20-12-4-2-11(17)3-5-12/h1,6-7,9,11-12H,2-5,17H2,(H,18,19,20) |
| InChIKey | FFGMTZHNGLRJOZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |