C22H27N5O — CID 130294950
4-[[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)cyclohexyl]amino]quinazoline-6-carbonitrile (PubChem CID 130294950) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)cyclohexyl]amino]quinazoline-6-carbonitrile.
| Compound Name | 4-[[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)cyclohexyl]amino]quinazoline-6-carbonitrile |
|---|---|
| PubChem CID | 130294950 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 4-[[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)cyclohexyl]amino]quinazoline-6-carbonitrile |
| SMILES | N#Cc1ccc2ncnc(NC3CCC(N4CCOC5CCCC54)CC3)c2c1 |
| InChI | InChI=1S/C22H27N5O/c23-13-15-4-9-19-18(12-15)22(25-14-24-19)26-16-5-7-17(8-6-16)27-10-11-28-21-3-1-2-20(21)27/h4,9,12,14,16-17,20-21H,1-3,5-8,10-11H2,(H,24,25,26) |
| InChIKey | QEHIZFWPFNGHTJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |