C20H25N5O — CID 118475287
2-[4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-6-yl]acetonitrile (PubChem CID 118475287) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-6-yl]acetonitrile.
| Compound Name | 2-[4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-6-yl]acetonitrile |
|---|---|
| PubChem CID | 118475287 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 2-[4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-6-yl]acetonitrile |
| SMILES | N#CCc1ccc2ncnc(NC3CCC(N4CCOCC4)CC3)c2c1 |
| InChI | InChI=1S/C20H25N5O/c21-8-7-15-1-6-19-18(13-15)20(23-14-22-19)24-16-2-4-17(5-3-16)25-9-11-26-12-10-25/h1,6,13-14,16-17H,2-5,7,9-12H2,(H,22,23,24) |
| InChIKey | YGPUMOULFUKEOQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |