C24H30N4O2 — CID 130236172
3-[4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-6-yl]cyclohex-3-en-1-one (PubChem CID 130236172) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 3-[4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-6-yl]cyclohex-3-en-1-one.
| Compound Name | 3-[4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-6-yl]cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 130236172 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 3-[4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-6-yl]cyclohex-3-en-1-one |
| SMILES | O=C1CCC=C(c2ccc3ncnc(NC4CCC(N5CCOCC5)CC4)c3c2)C1 |
| InChI | InChI=1S/C24H30N4O2/c29-21-3-1-2-17(14-21)18-4-9-23-22(15-18)24(26-16-25-23)27-19-5-7-20(8-6-19)28-10-12-30-13-11-28/h2,4,9,15-16,19-20H,1,3,5-8,10-14H2,(H,25,26,27) |
| InChIKey | VRCXICAWFVZUKK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |