C23H34N4 — CID 118475354
N-[4-(4,4-dimethylpiperidin-1-yl)cyclohexyl]-6-ethylquinazolin-4-amine (PubChem CID 118475354) has the molecular formula C23H34N4 and a molecular weight of 366.55 g/mol. Its IUPAC name is N-[4-(4,4-dimethylpiperidin-1-yl)cyclohexyl]-6-ethylquinazolin-4-amine.
| Compound Name | N-[4-(4,4-dimethylpiperidin-1-yl)cyclohexyl]-6-ethylquinazolin-4-amine |
|---|---|
| PubChem CID | 118475354 |
| Molecular Formula | C23H34N4 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | N-[4-(4,4-dimethylpiperidin-1-yl)cyclohexyl]-6-ethylquinazolin-4-amine |
| SMILES | CCc1ccc2ncnc(NC3CCC(N4CCC(C)(C)CC4)CC3)c2c1 |
| InChI | InChI=1S/C23H34N4/c1-4-17-5-10-21-20(15-17)22(25-16-24-21)26-18-6-8-19(9-7-18)27-13-11-23(2,3)12-14-27/h5,10,15-16,18-19H,4,6-9,11-14H2,1-3H3,(H,24,25,26) |
| InChIKey | KWMYHFDJVLOWMD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |