C19H28N6 — CID 146237654
4-N-[4-(4-methylpiperazin-1-yl)cyclohexyl]quinazoline-4,6-diamine (PubChem CID 146237654) has the molecular formula C19H28N6 and a molecular weight of 340.48 g/mol. Its IUPAC name is 4-N-[4-(4-methylpiperazin-1-yl)cyclohexyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[4-(4-methylpiperazin-1-yl)cyclohexyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 146237654 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 4-N-[4-(4-methylpiperazin-1-yl)cyclohexyl]quinazoline-4,6-diamine |
| SMILES | CN1CCN(C2CCC(Nc3ncnc4ccc(N)cc34)CC2)CC1 |
| InChI | InChI=1S/C19H28N6/c1-24-8-10-25(11-9-24)16-5-3-15(4-6-16)23-19-17-12-14(20)2-7-18(17)21-13-22-19/h2,7,12-13,15-16H,3-6,8-11,20H2,1H3,(H,21,22,23) |
| InChIKey | YKGVKGUPHRXNMS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|