C13H16N4O2S — CID 64588325
4-N-(1,1-dioxothian-3-yl)quinazoline-4,6-diamine (PubChem CID 64588325) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-N-(1,1-dioxothian-3-yl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(1,1-dioxothian-3-yl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 64588325 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-N-(1,1-dioxothian-3-yl)quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(NC3CCCS(=O)(=O)C3)c2c1 |
| InChI | InChI=1S/C13H16N4O2S/c14-9-3-4-12-11(6-9)13(16-8-15-12)17-10-2-1-5-20(18,19)7-10/h3-4,6,8,10H,1-2,5,7,14H2,(H,15,16,17) |
| InChIKey | KRRMWIRYQNCJJP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|