C14H17N3O4S2 — CID 154740242
N-(1,1-dioxothian-3-yl)-6-methylsulfonylquinazolin-4-amine (PubChem CID 154740242) has the molecular formula C14H17N3O4S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-6-methylsulfonylquinazolin-4-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)-6-methylsulfonylquinazolin-4-amine |
|---|---|
| PubChem CID | 154740242 |
| Molecular Formula | C14H17N3O4S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-6-methylsulfonylquinazolin-4-amine |
| SMILES | CS(=O)(=O)c1ccc2ncnc(NC3CCCS(=O)(=O)C3)c2c1 |
| InChI | InChI=1S/C14H17N3O4S2/c1-22(18,19)11-4-5-13-12(7-11)14(16-9-15-13)17-10-3-2-6-23(20,21)8-10/h4-5,7,9-10H,2-3,6,8H2,1H3,(H,15,16,17) |
| InChIKey | DGPFPZFQLSXLEE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |