C14H15FN2O — CID 124678225
4-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-3-fluorobenzonitrile (PubChem CID 124678225) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is 4-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-3-fluorobenzonitrile.
| Compound Name | 4-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 124678225 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 4-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(N2CCO[C@@H]3CCC[C@H]32)c(F)c1 |
| InChI | InChI=1S/C14H15FN2O/c15-11-8-10(9-16)4-5-12(11)17-6-7-18-14-3-1-2-13(14)17/h4-5,8,13-14H,1-3,6-7H2/t13-,14-/m1/s1 |
| InChIKey | QPOGCPQMQXVMQL-ZIAGYGMSSA-N |
| XLogP | 2.46 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |