C15H29N3O3 — CID 121263921
N-[2-[[2-(3-methylbutylamino)-2-oxoethyl]amino]-2-oxoethyl]-N-propylpropanamide (PubChem CID 121263921) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is N-[2-[[2-(3-methylbutylamino)-2-oxoethyl]amino]-2-oxoethyl]-N-propylpropanamide.
| Compound Name | N-[2-[[2-(3-methylbutylamino)-2-oxoethyl]amino]-2-oxoethyl]-N-propylpropanamide |
|---|---|
| PubChem CID | 121263921 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | N-[2-[[2-(3-methylbutylamino)-2-oxoethyl]amino]-2-oxoethyl]-N-propylpropanamide |
| SMILES | CCCN(CC(=O)NCC(=O)NCCC(C)C)C(=O)CC |
| InChI | InChI=1S/C15H29N3O3/c1-5-9-18(15(21)6-2)11-14(20)17-10-13(19)16-8-7-12(3)4/h12H,5-11H2,1-4H3,(H,16,19)(H,17,20) |
| InChIKey | FRYCTDYZZHPHQE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |